C19H18N3O4+ — CID 53290567
4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one (PubChem CID 53290567) has the molecular formula C19H18N3O4+ and a molecular weight of 352.37 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 53290567 |
| Molecular Formula | C19H18N3O4+ |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2C(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C19H17N3O4/c1-25-16-8-6-15(7-9-16)22-17(19(24)26-20-22)18(23)21-11-10-13-4-2-3-5-14(13)12-21/h2-9H,10-12H2,1H3/p+1 |
| InChIKey | ZXKUBTRQWRQVMY-UHFFFAOYSA-O |
| XLogP | 1.45 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|