C18H16N3O3+ — CID 53290296
4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-phenyl-2H-oxadiazol-3-ium-5-one (PubChem CID 53290296) has the molecular formula C18H16N3O3+ and a molecular weight of 322.34 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-phenyl-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-phenyl-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 53290296 |
| Molecular Formula | C18H16N3O3+ |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-phenyl-2H-oxadiazol-3-ium-5-one |
| SMILES | O=C(c1c(=O)o[nH][n+]1-c1ccccc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H15N3O3/c22-17(20-11-10-13-6-4-5-7-14(13)12-20)16-18(23)24-19-21(16)15-8-2-1-3-9-15/h1-9H,10-12H2/p+1 |
| InChIKey | KREAMXSKQFHZRM-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|