C15H17N4O4+ — CID 53290314
1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-carbonyl)piperidine-4-carboxamide (PubChem CID 53290314) has the molecular formula C15H17N4O4+ and a molecular weight of 317.32 g/mol. Its IUPAC name is 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-carbonyl)piperidine-4-carboxamide.
| Compound Name | 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53290314 |
| Molecular Formula | C15H17N4O4+ |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-carbonyl)piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)c2c(=O)o[nH][n+]2-c2ccccc2)CC1 |
| InChI | InChI=1S/C15H16N4O4/c16-13(20)10-6-8-18(9-7-10)14(21)12-15(22)23-17-19(12)11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H2-,16,17,20,21,22)/p+1 |
| InChIKey | HMJRDLLYIANJPR-UHFFFAOYSA-O |
| XLogP | -0.42 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|