C16H23N3O2 — CID 110676358
1-N-(2-phenylpropan-2-yl)piperidine-1,4-dicarboxamide (PubChem CID 110676358) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-N-(2-phenylpropan-2-yl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-(2-phenylpropan-2-yl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 110676358 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-N-(2-phenylpropan-2-yl)piperidine-1,4-dicarboxamide |
| SMILES | CC(C)(NC(=O)N1CCC(C(N)=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C16H23N3O2/c1-16(2,13-6-4-3-5-7-13)18-15(21)19-10-8-12(9-11-19)14(17)20/h3-7,12H,8-11H2,1-2H3,(H2,17,20)(H,18,21) |
| InChIKey | CTFYXZVFHWYIFN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |