C16H24N2O3 — CID 113216584
N-[2-(3,4-dimethoxyphenyl)propan-2-yl]pyrrolidine-1-carboxamide (PubChem CID 113216584) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)propan-2-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)propan-2-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 113216584 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)propan-2-yl]pyrrolidine-1-carboxamide |
| SMILES | COc1ccc(C(C)(C)NC(=O)N2CCCC2)cc1OC |
| InChI | InChI=1S/C16H24N2O3/c1-16(2,17-15(19)18-9-5-6-10-18)12-7-8-13(20-3)14(11-12)21-4/h7-8,11H,5-6,9-10H2,1-4H3,(H,17,19) |
| InChIKey | FCPVLDLCZVZKOS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |