C17H25N3O2 — CID 95310200
(3S)-1-N-[(2R)-3-methyl-3-phenylbutan-2-yl]pyrrolidine-1,3-dicarboxamide (PubChem CID 95310200) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (3S)-1-N-[(2R)-3-methyl-3-phenylbutan-2-yl]pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-[(2R)-3-methyl-3-phenylbutan-2-yl]pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95310200 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (3S)-1-N-[(2R)-3-methyl-3-phenylbutan-2-yl]pyrrolidine-1,3-dicarboxamide |
| SMILES | C[C@@H](NC(=O)N1CC[C@H](C(N)=O)C1)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H25N3O2/c1-12(17(2,3)14-7-5-4-6-8-14)19-16(22)20-10-9-13(11-20)15(18)21/h4-8,12-13H,9-11H2,1-3H3,(H2,18,21)(H,19,22)/t12-,13+/m1/s1 |
| InChIKey | QTQYMTPLEOKWMT-OLZOCXBDSA-N |
| XLogP | 1.87 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |