C23H20N4O6S — CID 53290810
4-[2-[(4E)-4-[(2,4-dimethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53290810) has the molecular formula C23H20N4O6S and a molecular weight of 480.50 g/mol. Its IUPAC name is 4-[2-[(4E)-4-[(2,4-dimethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[2-[(4E)-4-[(2,4-dimethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53290810 |
| Molecular Formula | C23H20N4O6S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 4-[2-[(4E)-4-[(2,4-dimethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-methyloxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(/C=C2/N=C(SCC(=O)c3c([O-])on[n+]3C)N(c3ccccc3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C23H20N4O6S/c1-26-20(22(30)33-25-26)18(28)13-34-23-24-17(21(29)27(23)15-7-5-4-6-8-15)11-14-9-10-16(31-2)12-19(14)32-3/h4-12H,13H2,1-3H3/b17-11+ |
| InChIKey | ACBRSMBFCOYLFI-GZTJUZNOSA-N |
| XLogP | 1.95 |
| TPSA | 121.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|