C13H13N3O5S — CID 53291333
4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53291333) has the molecular formula C13H13N3O5S and a molecular weight of 323.33 g/mol. Its IUPAC name is 4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53291333 |
| Molecular Formula | C13H13N3O5S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
| SMILES | C[n+]1noc([O-])c1SCC(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H13N3O5S/c1-16-12(13(18)21-15-16)22-7-11(17)14-8-2-3-9-10(6-8)20-5-4-19-9/h2-3,6H,4-5,7H2,1H3,(H-,14,15,17,18) |
| InChIKey | PUFUVPNRFAUGRE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|