C18H15N3O5S — CID 53293399
4-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate (PubChem CID 53293399) has the molecular formula C18H15N3O5S and a molecular weight of 385.40 g/mol. Its IUPAC name is 4-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53293399 |
| Molecular Formula | C18H15N3O5S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 4-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate |
| SMILES | O=C(CCSc1c([O-])on[n+]1-c1ccccc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15N3O5S/c22-16(19-12-6-7-14-15(10-12)25-11-24-14)8-9-27-17-18(23)26-20-21(17)13-4-2-1-3-5-13/h1-7,10H,8-9,11H2,(H-,19,20,22,23) |
| InChIKey | CCOXNURIJPBVJF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|