C17H13N4O5S- — CID 54731001
4-[3-[(4-nitrobenzene-6-id-1-yl)amino]-3-oxopropyl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate (PubChem CID 54731001) has the molecular formula C17H13N4O5S- and a molecular weight of 385.38 g/mol. Its IUPAC name is 4-[3-[(4-nitrobenzene-6-id-1-yl)amino]-3-oxopropyl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[3-[(4-nitrobenzene-6-id-1-yl)amino]-3-oxopropyl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 54731001 |
| Molecular Formula | C17H13N4O5S- |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 4-[3-[(4-nitrobenzene-6-id-1-yl)amino]-3-oxopropyl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate |
| SMILES | O=C(CCSc1c([O-])on[n+]1-c1ccccc1)Nc1[c-]cc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H14N4O5S/c22-15(18-12-6-8-14(9-7-12)21(24)25)10-11-27-16-17(23)26-19-20(16)13-4-2-1-3-5-13/h1-6,8-9,23H,10-11H2,(H,18,22)/p-1 |
| InChIKey | MEWMWQGBPUNGAB-UHFFFAOYSA-M |
| XLogP | 1.85 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|