C10H9N3O3S — CID 53291727
4-(2-amino-2-oxoethyl)sulfanyl-3-phenyloxadiazol-3-ium-5-olate (PubChem CID 53291727) has the molecular formula C10H9N3O3S and a molecular weight of 251.27 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethyl)sulfanyl-3-phenyloxadiazol-3-ium-5-olate.
| Compound Name | 4-(2-amino-2-oxoethyl)sulfanyl-3-phenyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53291727 |
| Molecular Formula | C10H9N3O3S |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 4-(2-amino-2-oxoethyl)sulfanyl-3-phenyloxadiazol-3-ium-5-olate |
| SMILES | NC(=O)CSc1c([O-])on[n+]1-c1ccccc1 |
| InChI | InChI=1S/C10H9N3O3S/c11-8(14)6-17-9-10(15)16-12-13(9)7-4-2-1-3-5-7/h1-5H,6H2,(H2-,11,12,14,15) |
| InChIKey | XWXLWLOMMKZFCI-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|