C17H11Br3N2O3 — CID 16755906
4-[2,3-dibromo-3-(4-bromophenyl)propanoyl]-3-phenyloxadiazol-3-ium-5-olate (PubChem CID 16755906) has the molecular formula C17H11Br3N2O3 and a molecular weight of 531.00 g/mol. Its IUPAC name is 4-[2,3-dibromo-3-(4-bromophenyl)propanoyl]-3-phenyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[2,3-dibromo-3-(4-bromophenyl)propanoyl]-3-phenyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 16755906 |
| Molecular Formula | C17H11Br3N2O3 |
| Molecular Weight | 531.00 g/mol |
| Exact Mass | 527.83 |
| IUPAC Name | 4-[2,3-dibromo-3-(4-bromophenyl)propanoyl]-3-phenyloxadiazol-3-ium-5-olate |
| SMILES | O=C(c1c([O-])on[n+]1-c1ccccc1)C(Br)C(Br)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H11Br3N2O3/c18-11-8-6-10(7-9-11)13(19)14(20)16(23)15-17(24)25-21-22(15)12-4-2-1-3-5-12/h1-9,13-14H |
| InChIKey | QQUSTKMNPZPFGZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.00 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|