C18H17Br3O5 — CID 44551937
2,3-dibromo-3-(4-bromophenyl)-1-[5-[(3R,4R)-3,4-dihydroxyoxolan-2-yl]-2-methylfuran-3-yl]propan-1-one (PubChem CID 44551937) has the molecular formula C18H17Br3O5 and a molecular weight of 553.04 g/mol. Its IUPAC name is 2,3-dibromo-3-(4-bromophenyl)-1-[5-[(3R,4R)-3,4-dihydroxyoxolan-2-yl]-2-methylfuran-3-yl]propan-1-one.
| Compound Name | 2,3-dibromo-3-(4-bromophenyl)-1-[5-[(3R,4R)-3,4-dihydroxyoxolan-2-yl]-2-methylfuran-3-yl]propan-1-one |
|---|---|
| PubChem CID | 44551937 |
| Molecular Formula | C18H17Br3O5 |
| Molecular Weight | 553.04 g/mol |
| Exact Mass | 549.86 |
| IUPAC Name | 2,3-dibromo-3-(4-bromophenyl)-1-[5-[(3R,4R)-3,4-dihydroxyoxolan-2-yl]-2-methylfuran-3-yl]propan-1-one |
| SMILES | Cc1oc(C2OC[C@@H](O)[C@H]2O)cc1C(=O)C(Br)C(Br)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H17Br3O5/c1-8-11(6-13(26-8)18-17(24)12(22)7-25-18)16(23)15(21)14(20)9-2-4-10(19)5-3-9/h2-6,12,14-15,17-18,22,24H,7H2,1H3/t12-,14?,15?,17-,18?/m1/s1 |
| InChIKey | YXALOABHLXZXLT-ZZPWAIOCSA-N |
| XLogP | 4.23 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.04 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|