C10H9Br2ClO — CID 3755690
3,4-dibromo-4-(4-chlorophenyl)butan-2-one (PubChem CID 3755690) has the molecular formula C10H9Br2ClO and a molecular weight of 340.44 g/mol. Its IUPAC name is 3,4-dibromo-4-(4-chlorophenyl)butan-2-one.
| Compound Name | 3,4-dibromo-4-(4-chlorophenyl)butan-2-one |
|---|---|
| PubChem CID | 3755690 |
| Molecular Formula | C10H9Br2ClO |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 337.87 |
| IUPAC Name | 3,4-dibromo-4-(4-chlorophenyl)butan-2-one |
| SMILES | CC(=O)C(Br)C(Br)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H9Br2ClO/c1-6(14)9(11)10(12)7-2-4-8(13)5-3-7/h2-5,9-10H,1H3 |
| InChIKey | NNLXNPXDVHOGCR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|