C17H14Br2Cl2O — CID 174623218
(1S,5S)-1,5-dibromo-1,5-bis(4-chlorophenyl)pentan-3-one (PubChem CID 174623218) has the molecular formula C17H14Br2Cl2O and a molecular weight of 465.01 g/mol. Its IUPAC name is (1S,5S)-1,5-dibromo-1,5-bis(4-chlorophenyl)pentan-3-one.
| Compound Name | (1S,5S)-1,5-dibromo-1,5-bis(4-chlorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 174623218 |
| Molecular Formula | C17H14Br2Cl2O |
| Molecular Weight | 465.01 g/mol |
| Exact Mass | 461.88 |
| IUPAC Name | (1S,5S)-1,5-dibromo-1,5-bis(4-chlorophenyl)pentan-3-one |
| SMILES | O=C(C[C@H](Br)c1ccc(Cl)cc1)C[C@H](Br)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14Br2Cl2O/c18-16(11-1-5-13(20)6-2-11)9-15(22)10-17(19)12-3-7-14(21)8-4-12/h1-8,16-17H,9-10H2/t16-,17-/m0/s1 |
| InChIKey | ZITMFEJSYLRUHV-IRXDYDNUSA-N |
| XLogP | 6.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.01 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|