C27H20Cl4N2O — CID 175279063
1,5-bis(4-chlorophenyl)-1,5-bis(4-chloro-2-pyridinyl)pentan-3-one (PubChem CID 175279063) has the molecular formula C27H20Cl4N2O and a molecular weight of 530.28 g/mol. Its IUPAC name is 1,5-bis(4-chlorophenyl)-1,5-bis(4-chloro-2-pyridinyl)pentan-3-one.
| Compound Name | 1,5-bis(4-chlorophenyl)-1,5-bis(4-chloro-2-pyridinyl)pentan-3-one |
|---|---|
| PubChem CID | 175279063 |
| Molecular Formula | C27H20Cl4N2O |
| Molecular Weight | 530.28 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | 1,5-bis(4-chlorophenyl)-1,5-bis(4-chloro-2-pyridinyl)pentan-3-one |
| SMILES | O=C(CC(c1ccc(Cl)cc1)c1cc(Cl)ccn1)CC(c1ccc(Cl)cc1)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C27H20Cl4N2O/c28-19-5-1-17(2-6-19)24(26-13-21(30)9-11-32-26)15-23(34)16-25(18-3-7-20(29)8-4-18)27-14-22(31)10-12-33-27/h1-14,24-25H,15-16H2 |
| InChIKey | QLVXMHIGHMGBRM-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.28 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |