C17H14IN3O3S — CID 53292603
4-[1-(4-iodoanilino)-1-oxopropan-2-yl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate (PubChem CID 53292603) has the molecular formula C17H14IN3O3S and a molecular weight of 467.29 g/mol. Its IUPAC name is 4-[1-(4-iodoanilino)-1-oxopropan-2-yl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[1-(4-iodoanilino)-1-oxopropan-2-yl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53292603 |
| Molecular Formula | C17H14IN3O3S |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 466.98 |
| IUPAC Name | 4-[1-(4-iodoanilino)-1-oxopropan-2-yl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate |
| SMILES | CC(Sc1c([O-])on[n+]1-c1ccccc1)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C17H14IN3O3S/c1-11(15(22)19-13-9-7-12(18)8-10-13)25-16-17(23)24-20-21(16)14-5-3-2-4-6-14/h2-11H,1H3,(H-,19,20,22,23) |
| InChIKey | XZEDVOPFUNSRDB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|