C18H15Cl2N3O4S — CID 53292679
4-[1-(3,4-dichloroanilino)-1-oxopropan-2-yl]sulfanyl-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate (PubChem CID 53292679) has the molecular formula C18H15Cl2N3O4S and a molecular weight of 440.31 g/mol. Its IUPAC name is 4-[1-(3,4-dichloroanilino)-1-oxopropan-2-yl]sulfanyl-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-[1-(3,4-dichloroanilino)-1-oxopropan-2-yl]sulfanyl-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53292679 |
| Molecular Formula | C18H15Cl2N3O4S |
| Molecular Weight | 440.31 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | 4-[1-(3,4-dichloroanilino)-1-oxopropan-2-yl]sulfanyl-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(-[n+]2noc([O-])c2SC(C)C(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H15Cl2N3O4S/c1-10(16(24)21-11-3-8-14(19)15(20)9-11)28-17-18(25)27-22-23(17)12-4-6-13(26-2)7-5-12/h3-10H,1-2H3,(H-,21,22,24,25) |
| InChIKey | OHLMTMFTOHOCKY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|