C17H13Cl2N3O4S — CID 53292383
4-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanyl-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate (PubChem CID 53292383) has the molecular formula C17H13Cl2N3O4S and a molecular weight of 426.28 g/mol. Its IUPAC name is 4-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanyl-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanyl-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53292383 |
| Molecular Formula | C17H13Cl2N3O4S |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 4-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanyl-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(-[n+]2noc([O-])c2SCC(=O)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H13Cl2N3O4S/c1-25-12-5-3-11(4-6-12)22-16(17(24)26-21-22)27-9-15(23)20-14-7-2-10(18)8-13(14)19/h2-8H,9H2,1H3,(H-,20,21,23,24) |
| InChIKey | UIGIALJUDZAXDC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|