C12H12ClN3O4S — CID 53291565
4-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53291565) has the molecular formula C12H12ClN3O4S and a molecular weight of 329.77 g/mol. Its IUPAC name is 4-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53291565 |
| Molecular Formula | C12H12ClN3O4S |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 4-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1c([O-])on[n+]1C |
| InChI | InChI=1S/C12H12ClN3O4S/c1-16-11(12(18)20-15-16)21-6-10(17)14-8-5-7(13)3-4-9(8)19-2/h3-5H,6H2,1-2H3,(H-,14,15,17,18) |
| InChIKey | UJALSHGKWMNLJG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|