C20H19N3O6S — CID 53293533
4-[3-(5-carboxy-2-methylanilino)-3-oxopropyl]sulfanyl-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate (PubChem CID 53293533) has the molecular formula C20H19N3O6S and a molecular weight of 429.45 g/mol. Its IUPAC name is 4-[3-(5-carboxy-2-methylanilino)-3-oxopropyl]sulfanyl-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-[3-(5-carboxy-2-methylanilino)-3-oxopropyl]sulfanyl-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53293533 |
| Molecular Formula | C20H19N3O6S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 4-[3-(5-carboxy-2-methylanilino)-3-oxopropyl]sulfanyl-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(-[n+]2noc([O-])c2SCCC(=O)Nc2cc(C(=O)O)ccc2C)cc1 |
| InChI | InChI=1S/C20H19N3O6S/c1-12-3-4-13(19(25)26)11-16(12)21-17(24)9-10-30-18-20(27)29-22-23(18)14-5-7-15(28-2)8-6-14/h3-8,11H,9-10H2,1-2H3,(H2-,21,22,24,25,26,27) |
| InChIKey | VGHYSBRFDFJNAZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|