C20H20N3O6S+ — CID 53293534
3-[3-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]propanoylamino]-4-methylbenzoic acid (PubChem CID 53293534) has the molecular formula C20H20N3O6S+ and a molecular weight of 430.46 g/mol. Its IUPAC name is 3-[3-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]propanoylamino]-4-methylbenzoic acid.
| Compound Name | 3-[3-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]propanoylamino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 53293534 |
| Molecular Formula | C20H20N3O6S+ |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 3-[3-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]propanoylamino]-4-methylbenzoic acid |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2SCCC(=O)Nc2cc(C(=O)O)ccc2C)cc1 |
| InChI | InChI=1S/C20H19N3O6S/c1-12-3-4-13(19(25)26)11-16(12)21-17(24)9-10-30-18-20(27)29-22-23(18)14-5-7-15(28-2)8-6-14/h3-8,11H,9-10H2,1-2H3,(H2-,21,22,24,25,26,27)/p+1 |
| InChIKey | VGHYSBRFDFJNAZ-UHFFFAOYSA-O |
| XLogP | 2.38 |
| TPSA | 125.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|