C22H24N3O5S+ — CID 53293396
butyl 4-[3-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanoylamino]benzoate (PubChem CID 53293396) has the molecular formula C22H24N3O5S+ and a molecular weight of 442.52 g/mol. Its IUPAC name is butyl 4-[3-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanoylamino]benzoate.
| Compound Name | butyl 4-[3-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 53293396 |
| Molecular Formula | C22H24N3O5S+ |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | butyl 4-[3-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CCSc2c(=O)o[nH][n+]2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23N3O5S/c1-2-3-14-29-21(27)16-9-11-17(12-10-16)23-19(26)13-15-31-20-22(28)30-24-25(20)18-7-5-4-6-8-18/h4-12H,2-3,13-15H2,1H3,(H-,23,24,26,27,28)/p+1 |
| InChIKey | JBXFEXZZJMKYJM-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|