C23H22N7O5S+ — CID 53296316
butyl 4-[[2-[[6-amino-3,5-dicyano-4-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)-2-pyridinyl]sulfanyl]acetyl]amino]benzoate (PubChem CID 53296316) has the molecular formula C23H22N7O5S+ and a molecular weight of 508.54 g/mol. Its IUPAC name is butyl 4-[[2-[[6-amino-3,5-dicyano-4-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)-2-pyridinyl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[[6-amino-3,5-dicyano-4-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)-2-pyridinyl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 53296316 |
| Molecular Formula | C23H22N7O5S+ |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | butyl 4-[[2-[[6-amino-3,5-dicyano-4-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)-2-pyridinyl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CSc2nc(N)c(C#N)c(-c3c(=O)o[nH][n+]3C)c2C#N)cc1 |
| InChI | InChI=1S/C23H21N7O5S/c1-3-4-9-34-22(32)13-5-7-14(8-6-13)27-17(31)12-36-21-16(11-25)18(15(10-24)20(26)28-21)19-23(33)35-29-30(19)2/h5-8H,3-4,9,12H2,1-2H3,(H3-,26,27,28,29,31,32,33)/p+1 |
| InChIKey | XKUKQBYRHHDCNK-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 191.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|