C12H11Cl2N3O3S — CID 53291887
4-[1-(2,4-dichloroanilino)-1-oxopropan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53291887) has the molecular formula C12H11Cl2N3O3S and a molecular weight of 348.21 g/mol. Its IUPAC name is 4-[1-(2,4-dichloroanilino)-1-oxopropan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[1-(2,4-dichloroanilino)-1-oxopropan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53291887 |
| Molecular Formula | C12H11Cl2N3O3S |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 4-[1-(2,4-dichloroanilino)-1-oxopropan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
| SMILES | CC(Sc1c([O-])on[n+]1C)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2N3O3S/c1-6(21-11-12(19)20-16-17(11)2)10(18)15-9-4-3-7(13)5-8(9)14/h3-6H,1-2H3,(H-,15,16,18,19) |
| InChIKey | VXWHKJDBSJHEAS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|