C12H12FN3O3S — CID 53293713
4-[3-(2-fluoroanilino)-3-oxopropyl]sulfanyl-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53293713) has the molecular formula C12H12FN3O3S and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-[3-(2-fluoroanilino)-3-oxopropyl]sulfanyl-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[3-(2-fluoroanilino)-3-oxopropyl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53293713 |
| Molecular Formula | C12H12FN3O3S |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-[3-(2-fluoroanilino)-3-oxopropyl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
| SMILES | C[n+]1noc([O-])c1SCCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C12H12FN3O3S/c1-16-11(12(18)19-15-16)20-7-6-10(17)14-9-5-3-2-4-8(9)13/h2-5H,6-7H2,1H3,(H-,14,15,17,18) |
| InChIKey | RWYMWPMIQRCYQJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|