C11H9N4O5S- — CID 54730984
3-methyl-4-[2-[(4-nitrobenzene-6-id-1-yl)amino]-2-oxoethyl]sulfanyloxadiazol-3-ium-5-olate (PubChem CID 54730984) has the molecular formula C11H9N4O5S- and a molecular weight of 309.28 g/mol. Its IUPAC name is 3-methyl-4-[2-[(4-nitrobenzene-6-id-1-yl)amino]-2-oxoethyl]sulfanyloxadiazol-3-ium-5-olate.
| Compound Name | 3-methyl-4-[2-[(4-nitrobenzene-6-id-1-yl)amino]-2-oxoethyl]sulfanyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 54730984 |
| Molecular Formula | C11H9N4O5S- |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 3-methyl-4-[2-[(4-nitrobenzene-6-id-1-yl)amino]-2-oxoethyl]sulfanyloxadiazol-3-ium-5-olate |
| SMILES | C[n+]1noc([O-])c1SCC(=O)Nc1[c-]cc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H10N4O5S/c1-14-10(11(17)20-13-14)21-6-9(16)12-7-2-4-8(5-3-7)15(18)19/h2,4-5,17H,6H2,1H3,(H,12,16)/p-1 |
| InChIKey | YPZPEZKUYUIRDH-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|