C12H13N4O5S+ — CID 53291580
N-(2-methyl-4-nitrophenyl)-2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]acetamide (PubChem CID 53291580) has the molecular formula C12H13N4O5S+ and a molecular weight of 325.33 g/mol. Its IUPAC name is N-(2-methyl-4-nitrophenyl)-2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]acetamide.
| Compound Name | N-(2-methyl-4-nitrophenyl)-2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 53291580 |
| Molecular Formula | C12H13N4O5S+ |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-(2-methyl-4-nitrophenyl)-2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CSc1c(=O)o[nH][n+]1C |
| InChI | InChI=1S/C12H12N4O5S/c1-7-5-8(16(19)20)3-4-9(7)13-10(17)6-22-11-12(18)21-14-15(11)2/h3-5H,6H2,1-2H3,(H-,13,14,17,18)/p+1 |
| InChIKey | IXIWADXIGOOOAX-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|