C22H18N4O6 — CID 5329256
(E)-2-cyano-N-[2-[[(E)-2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]ethyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide (PubChem CID 5329256) has the molecular formula C22H18N4O6 and a molecular weight of 434.41 g/mol. Its IUPAC name is (E)-2-cyano-N-[2-[[(E)-2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]ethyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[2-[[(E)-2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]ethyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5329256 |
| Molecular Formula | C22H18N4O6 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | (E)-2-cyano-N-[2-[[(E)-2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]ethyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(O)c(O)c1)C(=O)NCCNC(=O)/C(C#N)=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H18N4O6/c23-11-15(7-13-1-3-17(27)19(29)9-13)21(31)25-5-6-26-22(32)16(12-24)8-14-2-4-18(28)20(30)10-14/h1-4,7-10,27-30H,5-6H2,(H,25,31)(H,26,32)/b15-7+,16-8+ |
| InChIKey | PZIRTMUUDNWDHP-BGPOSVGRSA-N |
| XLogP | 1.26 |
| TPSA | 186.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|