C19H18F2N3O4S+ — CID 53292918
N-(3,4-difluorophenyl)-2-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]butanamide (PubChem CID 53292918) has the molecular formula C19H18F2N3O4S+ and a molecular weight of 422.43 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]butanamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 53292918 |
| Molecular Formula | C19H18F2N3O4S+ |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]butanamide |
| SMILES | CCC(Sc1c(=O)o[nH][n+]1-c1ccc(OC)cc1)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H17F2N3O4S/c1-3-16(17(25)22-11-4-9-14(20)15(21)10-11)29-18-19(26)28-23-24(18)12-5-7-13(27-2)8-6-12/h4-10,16H,3H2,1-2H3,(H-,22,23,25,26)/p+1 |
| InChIKey | GKBAIJJTHIAHSY-UHFFFAOYSA-O |
| XLogP | 3.04 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|