C14H17ClN3O3S+ — CID 53292452
N-(3-chloro-4-methylphenyl)-2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]butanamide (PubChem CID 53292452) has the molecular formula C14H17ClN3O3S+ and a molecular weight of 342.83 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]butanamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 53292452 |
| Molecular Formula | C14H17ClN3O3S+ |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]butanamide |
| SMILES | CCC(Sc1c(=O)o[nH][n+]1C)C(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClN3O3S/c1-4-11(22-13-14(20)21-17-18(13)3)12(19)16-9-6-5-8(2)10(15)7-9/h5-7,11H,4H2,1-3H3,(H-,16,17,19,20)/p+1 |
| InChIKey | YTUKCPBEPYDZDP-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 78.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|