C14H18N3O3S+ — CID 53293124
2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]-N-(2-methylphenyl)butanamide (PubChem CID 53293124) has the molecular formula C14H18N3O3S+ and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]-N-(2-methylphenyl)butanamide.
| Compound Name | 2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]-N-(2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 53293124 |
| Molecular Formula | C14H18N3O3S+ |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]-N-(2-methylphenyl)butanamide |
| SMILES | CCC(Sc1c(=O)o[nH][n+]1C)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C14H17N3O3S/c1-4-11(21-13-14(19)20-16-17(13)3)12(18)15-10-8-6-5-7-9(10)2/h5-8,11H,4H2,1-3H3,(H-,15,16,18,19)/p+1 |
| InChIKey | IUFBJRQYTSSUHE-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 78.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|