C19H17F3N3O4S+ — CID 53292992
2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]-N-[2-(trifluoromethoxy)phenyl]butanamide (PubChem CID 53292992) has the molecular formula C19H17F3N3O4S+ and a molecular weight of 440.42 g/mol. Its IUPAC name is 2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]-N-[2-(trifluoromethoxy)phenyl]butanamide.
| Compound Name | 2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]-N-[2-(trifluoromethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 53292992 |
| Molecular Formula | C19H17F3N3O4S+ |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]-N-[2-(trifluoromethoxy)phenyl]butanamide |
| SMILES | CCC(Sc1c(=O)o[nH][n+]1-c1ccccc1)C(=O)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C19H16F3N3O4S/c1-2-15(16(26)23-13-10-6-7-11-14(13)28-19(20,21)22)30-17-18(27)29-24-25(17)12-8-4-3-5-9-12/h3-11,15H,2H2,1H3,(H-,23,24,26,27)/p+1 |
| InChIKey | ZJQCNHXKGWSEEY-UHFFFAOYSA-O |
| XLogP | 3.65 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|