C14H14F3N3O4S — CID 53292989
3-methyl-4-[1-oxo-1-[2-(trifluoromethoxy)anilino]butan-2-yl]sulfanyloxadiazol-3-ium-5-olate (PubChem CID 53292989) has the molecular formula C14H14F3N3O4S and a molecular weight of 377.34 g/mol. Its IUPAC name is 3-methyl-4-[1-oxo-1-[2-(trifluoromethoxy)anilino]butan-2-yl]sulfanyloxadiazol-3-ium-5-olate.
| Compound Name | 3-methyl-4-[1-oxo-1-[2-(trifluoromethoxy)anilino]butan-2-yl]sulfanyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53292989 |
| Molecular Formula | C14H14F3N3O4S |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 3-methyl-4-[1-oxo-1-[2-(trifluoromethoxy)anilino]butan-2-yl]sulfanyloxadiazol-3-ium-5-olate |
| SMILES | CCC(Sc1c([O-])on[n+]1C)C(=O)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H14F3N3O4S/c1-3-10(25-12-13(22)24-19-20(12)2)11(21)18-8-6-4-5-7-9(8)23-14(15,16)17/h4-7,10H,3H2,1-2H3,(H-,18,19,21,22) |
| InChIKey | VPMOVGZMXRKZFW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|