C13H13Cl2N3O3S — CID 53293337
4-[1-(2,3-dichloroanilino)-1-oxobutan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53293337) has the molecular formula C13H13Cl2N3O3S and a molecular weight of 362.24 g/mol. Its IUPAC name is 4-[1-(2,3-dichloroanilino)-1-oxobutan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[1-(2,3-dichloroanilino)-1-oxobutan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53293337 |
| Molecular Formula | C13H13Cl2N3O3S |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 4-[1-(2,3-dichloroanilino)-1-oxobutan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
| SMILES | CCC(Sc1c([O-])on[n+]1C)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H13Cl2N3O3S/c1-3-9(22-12-13(20)21-17-18(12)2)11(19)16-8-6-4-5-7(14)10(8)15/h4-6,9H,3H2,1-2H3,(H-,16,17,19,20) |
| InChIKey | ZESWQJCKTYXJHS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|