C14H13ClF3N3O3S — CID 53293141
4-[1-[4-chloro-2-(trifluoromethyl)anilino]-1-oxobutan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53293141) has the molecular formula C14H13ClF3N3O3S and a molecular weight of 395.79 g/mol. Its IUPAC name is 4-[1-[4-chloro-2-(trifluoromethyl)anilino]-1-oxobutan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[1-[4-chloro-2-(trifluoromethyl)anilino]-1-oxobutan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53293141 |
| Molecular Formula | C14H13ClF3N3O3S |
| Molecular Weight | 395.79 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 4-[1-[4-chloro-2-(trifluoromethyl)anilino]-1-oxobutan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
| SMILES | CCC(Sc1c([O-])on[n+]1C)C(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C14H13ClF3N3O3S/c1-3-10(25-12-13(23)24-20-21(12)2)11(22)19-9-5-4-7(15)6-8(9)14(16,17)18/h4-6,10H,3H2,1-2H3,(H-,19,20,22,23) |
| InChIKey | DPVJPTKSLLNIOP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.79 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|