C17H13F3N3O4S+ — CID 53291380
2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]-N-[2-(trifluoromethoxy)phenyl]acetamide (PubChem CID 53291380) has the molecular formula C17H13F3N3O4S+ and a molecular weight of 412.37 g/mol. Its IUPAC name is 2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]-N-[2-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]-N-[2-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 53291380 |
| Molecular Formula | C17H13F3N3O4S+ |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]-N-[2-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CSc1c(=O)o[nH][n+]1-c1ccccc1)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C17H12F3N3O4S/c18-17(19,20)26-13-9-5-4-8-12(13)21-14(24)10-28-15-16(25)27-22-23(15)11-6-2-1-3-7-11/h1-9H,10H2,(H-,21,22,24,25)/p+1 |
| InChIKey | FCFCGDUKDIUIKD-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|