C14H17N4O4S+ — CID 53292874
4-[2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]butanoylamino]benzamide (PubChem CID 53292874) has the molecular formula C14H17N4O4S+ and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]butanoylamino]benzamide.
| Compound Name | 4-[2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]butanoylamino]benzamide |
|---|---|
| PubChem CID | 53292874 |
| Molecular Formula | C14H17N4O4S+ |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 4-[2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]butanoylamino]benzamide |
| SMILES | CCC(Sc1c(=O)o[nH][n+]1C)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C14H16N4O4S/c1-3-10(23-13-14(21)22-17-18(13)2)12(20)16-9-6-4-8(5-7-9)11(15)19/h4-7,10H,3H2,1-2H3,(H3-,15,16,17,19,20,21)/p+1 |
| InChIKey | OCAVGFIRHMEKDK-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|