C14H18N3O4S+ — CID 53291912
N-(4-ethoxyphenyl)-2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanamide (PubChem CID 53291912) has the molecular formula C14H18N3O4S+ and a molecular weight of 324.38 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 53291912 |
| Molecular Formula | C14H18N3O4S+ |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanamide |
| SMILES | CCOc1ccc(NC(=O)C(C)Sc2c(=O)o[nH][n+]2C)cc1 |
| InChI | InChI=1S/C14H17N3O4S/c1-4-20-11-7-5-10(6-8-11)15-12(18)9(2)22-13-14(19)21-16-17(13)3/h5-9H,4H2,1-3H3,(H-,15,16,18,19)/p+1 |
| InChIKey | KQOFQPWFAKLPCR-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|