C18H17N4O4S+ — CID 53292820
4-[2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanoylamino]benzamide (PubChem CID 53292820) has the molecular formula C18H17N4O4S+ and a molecular weight of 385.43 g/mol. Its IUPAC name is 4-[2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanoylamino]benzamide.
| Compound Name | 4-[2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanoylamino]benzamide |
|---|---|
| PubChem CID | 53292820 |
| Molecular Formula | C18H17N4O4S+ |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 4-[2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanoylamino]benzamide |
| SMILES | CC(Sc1c(=O)o[nH][n+]1-c1ccccc1)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C18H16N4O4S/c1-11(16(24)20-13-9-7-12(8-10-13)15(19)23)27-17-18(25)26-21-22(17)14-5-3-2-4-6-14/h2-11H,1H3,(H3-,19,20,21,23,24,25)/p+1 |
| InChIKey | ZRALKCHGHQQOAH-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|