C20H22N3O3S+ — CID 53292842
N-(2-ethyl-6-methylphenyl)-2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanamide (PubChem CID 53292842) has the molecular formula C20H22N3O3S+ and a molecular weight of 384.48 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanamide.
| Compound Name | N-(2-ethyl-6-methylphenyl)-2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 53292842 |
| Molecular Formula | C20H22N3O3S+ |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanamide |
| SMILES | CCc1cccc(C)c1NC(=O)C(C)Sc1c(=O)o[nH][n+]1-c1ccccc1 |
| InChI | InChI=1S/C20H21N3O3S/c1-4-15-10-8-9-13(2)17(15)21-18(24)14(3)27-19-20(25)26-22-23(19)16-11-6-5-7-12-16/h5-12,14H,4H2,1-3H3,(H-,21,22,24,25)/p+1 |
| InChIKey | OKUFWZRIFJAMSS-UHFFFAOYSA-O |
| XLogP | 3.23 |
| TPSA | 78.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|