About 2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine
2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine (PubChem CID 53301186) has the molecular formula C18H20N4O
and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine |
| PubChem CID | 53301186 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine |
| SMILES | COc1ccc(Nc2c(C3CC3)nc3nc(C)cc(C)n23)cc1 |
| InChI | InChI=1S/C18H20N4O/c1-11-10-12(2)22-17(16(13-4-5-13)21-18(22)19-11)20-14-6-8-15(23-3)9-7-14/h6-10,13,20H,4-5H2,1-3H3 |
| InChIKey | TXQPXKOJSXSGDC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine?
The IUPAC name of 2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine (CID 53301186) is 2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine.
What is the SMILES notation for 2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine?
The canonical SMILES for 2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine is COc1ccc(Nc2c(C3CC3)nc3nc(C)cc(C)n23)cc1.
What is the InChIKey of 2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine?
The InChIKey is TXQPXKOJSXSGDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O/c1-11-10-12(2)22-17(16(13-4-5-13)21-18(22)19-11)20-14-6-8-15(23-3)9-7-14/h6-10,13,20H,4-5H2,1-3H3.
What are the key properties of 2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine?
2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine has a molecular weight of 308.39 g/mol, XLogP of 3.98, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-(4-methoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyrimidin-3-amine is sourced from PubChem (CID 53301186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).