C9H13NO4S — CID 53301849
3-[[(1S)-cyclohexa-2,4-dien-1-yl]amino]-2-oxopropane-1-sulfonic acid (PubChem CID 53301849) has the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. Its IUPAC name is 3-[[(1S)-cyclohexa-2,4-dien-1-yl]amino]-2-oxopropane-1-sulfonic acid.
| Compound Name | 3-[[(1S)-cyclohexa-2,4-dien-1-yl]amino]-2-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 53301849 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 3-[[(1S)-cyclohexa-2,4-dien-1-yl]amino]-2-oxopropane-1-sulfonic acid |
| SMILES | O=C(CN[C@@H]1C=CC=CC1)CS(=O)(=O)O |
| InChI | InChI=1S/C9H13NO4S/c11-9(7-15(12,13)14)6-10-8-4-2-1-3-5-8/h1-4,8,10H,5-7H2,(H,12,13,14)/t8-/m1/s1 |
| InChIKey | VPQVFBXLZKIHMY-MRVPVSSYSA-N |
| XLogP | -0.08 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|