C26H26N4O — CID 53301980
12-benzyl-4-methylspiro[12,14,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,15-hexaene-9,1'-cyclohexane]-11-one (PubChem CID 53301980) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 12-benzyl-4-methylspiro[12,14,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,15-hexaene-9,1'-cyclohexane]-11-one.
| Compound Name | 12-benzyl-4-methylspiro[12,14,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,15-hexaene-9,1'-cyclohexane]-11-one |
|---|---|
| PubChem CID | 53301980 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 12-benzyl-4-methylspiro[12,14,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,15-hexaene-9,1'-cyclohexane]-11-one |
| SMILES | Cc1ccc2c(c1)-c1c(c(=O)n(Cc3ccccc3)c3nncn13)C1(CCCCC1)C2 |
| InChI | InChI=1S/C26H26N4O/c1-18-10-11-20-15-26(12-6-3-7-13-26)22-23(21(20)14-18)30-17-27-28-25(30)29(24(22)31)16-19-8-4-2-5-9-19/h2,4-5,8-11,14,17H,3,6-7,12-13,15-16H2,1H3 |
| InChIKey | NDEQGUREBBENFO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |