C24H24N2O2S — CID 5125777
3-[(4-methoxyphenyl)methyl]-2-sulfanylidenespiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclopentane]-4-one (PubChem CID 5125777) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-2-sulfanylidenespiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclopentane]-4-one.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-2-sulfanylidenespiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclopentane]-4-one |
|---|---|
| PubChem CID | 5125777 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-2-sulfanylidenespiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclopentane]-4-one |
| SMILES | COc1ccc(Cn2c(=S)[nH]c3c(c2=O)C2(CCCC2)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C24H24N2O2S/c1-28-18-10-8-16(9-11-18)15-26-22(27)20-21(25-23(26)29)19-7-3-2-6-17(19)14-24(20)12-4-5-13-24/h2-3,6-11H,4-5,12-15H2,1H3,(H,25,29) |
| InChIKey | RNVFFFOLSZJBRZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|