C19H23IN2O2S — CID 134257148
3-[2-(3-iodopropoxy)ethyl]-5,5-dimethyl-2-sulfanylidene-1,6-dihydrobenzo[h]quinazolin-4-one (PubChem CID 134257148) has the molecular formula C19H23IN2O2S and a molecular weight of 470.38 g/mol. Its IUPAC name is 3-[2-(3-iodopropoxy)ethyl]-5,5-dimethyl-2-sulfanylidene-1,6-dihydrobenzo[h]quinazolin-4-one.
| Compound Name | 3-[2-(3-iodopropoxy)ethyl]-5,5-dimethyl-2-sulfanylidene-1,6-dihydrobenzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 134257148 |
| Molecular Formula | C19H23IN2O2S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 3-[2-(3-iodopropoxy)ethyl]-5,5-dimethyl-2-sulfanylidene-1,6-dihydrobenzo[h]quinazolin-4-one |
| SMILES | CC1(C)Cc2ccccc2-c2[nH]c(=S)n(CCOCCCI)c(=O)c21 |
| InChI | InChI=1S/C19H23IN2O2S/c1-19(2)12-13-6-3-4-7-14(13)16-15(19)17(23)22(18(25)21-16)9-11-24-10-5-8-20/h3-4,6-7H,5,8-12H2,1-2H3,(H,21,25) |
| InChIKey | HPPYGDHNVDYLCE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|