C23H22N4OS — CID 3763694
12-benzyl-9-ethyl-9-methyl-16-sulfanylidene-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,13-pentaen-11-one (PubChem CID 3763694) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is 12-benzyl-9-ethyl-9-methyl-16-sulfanylidene-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,13-pentaen-11-one.
| Compound Name | 12-benzyl-9-ethyl-9-methyl-16-sulfanylidene-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,13-pentaen-11-one |
|---|---|
| PubChem CID | 3763694 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 12-benzyl-9-ethyl-9-methyl-16-sulfanylidene-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,13-pentaen-11-one |
| SMILES | CCC1(C)Cc2ccccc2-c2c1c(=O)n(Cc1ccccc1)c1n[nH]c(=S)n21 |
| InChI | InChI=1S/C23H22N4OS/c1-3-23(2)13-16-11-7-8-12-17(16)19-18(23)20(28)26(14-15-9-5-4-6-10-15)21-24-25-22(29)27(19)21/h4-12H,3,13-14H2,1-2H3,(H,25,29) |
| InChIKey | XLQHGPHCSKHJQY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|