C19H22N2O2 — CID 20897586
3-cyclopentyl-5,5-dimethyl-1,6-dihydrobenzo[h]quinazoline-2,4-dione (PubChem CID 20897586) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-cyclopentyl-5,5-dimethyl-1,6-dihydrobenzo[h]quinazoline-2,4-dione.
| Compound Name | 3-cyclopentyl-5,5-dimethyl-1,6-dihydrobenzo[h]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 20897586 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 3-cyclopentyl-5,5-dimethyl-1,6-dihydrobenzo[h]quinazoline-2,4-dione |
| SMILES | CC1(C)Cc2ccccc2-c2[nH]c(=O)n(C3CCCC3)c(=O)c21 |
| InChI | InChI=1S/C19H22N2O2/c1-19(2)11-12-7-3-6-10-14(12)16-15(19)17(22)21(18(23)20-16)13-8-4-5-9-13/h3,6-7,10,13H,4-5,8-9,11H2,1-2H3,(H,20,23) |
| InChIKey | QXLXCTKIOGLVGJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |