C22H26N2OS — CID 1212774
3-(cyclopentylmethyl)-2-sulfanylidenespiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclopentane]-4-one (PubChem CID 1212774) has the molecular formula C22H26N2OS and a molecular weight of 366.53 g/mol. Its IUPAC name is 3-(cyclopentylmethyl)-2-sulfanylidenespiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclopentane]-4-one.
| Compound Name | 3-(cyclopentylmethyl)-2-sulfanylidenespiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclopentane]-4-one |
|---|---|
| PubChem CID | 1212774 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 3-(cyclopentylmethyl)-2-sulfanylidenespiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclopentane]-4-one |
| SMILES | O=c1c2c([nH]c(=S)n1CC1CCCC1)-c1ccccc1CC21CCCC1 |
| InChI | InChI=1S/C22H26N2OS/c25-20-18-19(23-21(26)24(20)14-15-7-1-2-8-15)17-10-4-3-9-16(17)13-22(18)11-5-6-12-22/h3-4,9-10,15H,1-2,5-8,11-14H2,(H,23,26) |
| InChIKey | FXCHRXLLPCVLDE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|