C19H24N2O2 — CID 20897573
5,5-diethyl-3-propyl-1,6-dihydrobenzo[h]quinazoline-2,4-dione (PubChem CID 20897573) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 5,5-diethyl-3-propyl-1,6-dihydrobenzo[h]quinazoline-2,4-dione.
| Compound Name | 5,5-diethyl-3-propyl-1,6-dihydrobenzo[h]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 20897573 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 5,5-diethyl-3-propyl-1,6-dihydrobenzo[h]quinazoline-2,4-dione |
| SMILES | CCCn1c(=O)[nH]c2c(c1=O)C(CC)(CC)Cc1ccccc1-2 |
| InChI | InChI=1S/C19H24N2O2/c1-4-11-21-17(22)15-16(20-18(21)23)14-10-8-7-9-13(14)12-19(15,5-2)6-3/h7-10H,4-6,11-12H2,1-3H3,(H,20,23) |
| InChIKey | BSOGGKBPMXMKSQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |